About 12,12-dimethoxydodec-1-ene
12,12-dimethoxydodec-1-ene (PubChem CID 135085656) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is 12,12-dimethoxydodec-1-ene.
Molecular Properties
| Compound Name | 12,12-dimethoxydodec-1-ene |
| PubChem CID | 135085656 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 12,12-dimethoxydodec-1-ene |
| SMILES | C=CCCCCCCCCCC(OC)OC |
| InChI | InChI=1S/C14H28O2/c1-4-5-6-7-8-9-10-11-12-13-14(15-2)16-3/h4,14H,1,5-13H2,2-3H3 |
| InChIKey | WHEBLKPWEGMNQK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 12,12-dimethoxydodec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12,12-dimethoxydodec-1-ene?
The IUPAC name of 12,12-dimethoxydodec-1-ene (CID 135085656) is 12,12-dimethoxydodec-1-ene.
What is the SMILES notation for 12,12-dimethoxydodec-1-ene?
The canonical SMILES for 12,12-dimethoxydodec-1-ene is C=CCCCCCCCCCC(OC)OC.
What is the InChIKey of 12,12-dimethoxydodec-1-ene?
The InChIKey is WHEBLKPWEGMNQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-4-5-6-7-8-9-10-11-12-13-14(15-2)16-3/h4,14H,1,5-13H2,2-3H3.
What are the key properties of 12,12-dimethoxydodec-1-ene?
12,12-dimethoxydodec-1-ene has a molecular weight of 228.38 g/mol, XLogP of 4.30, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12,12-dimethoxydodec-1-ene is sourced from PubChem (CID 135085656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).