About 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate
2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate (PubChem CID 135085711) has the molecular formula C10H19NO2Si
and a molecular weight of 213.35 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate |
| PubChem CID | 135085711 |
| Molecular Formula | C10H19NO2Si |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)N1C=CCC1 |
| InChI | InChI=1S/C10H19NO2Si/c1-14(2,3)9-8-13-10(12)11-6-4-5-7-11/h4,6H,5,7-9H2,1-3H3 |
| InChIKey | CXVZHVVEXHQZPA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate?
The IUPAC name of 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate (CID 135085711) is 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate.
What is the SMILES notation for 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate?
The canonical SMILES for 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate is C[Si](C)(C)CCOC(=O)N1C=CCC1.
What is the InChIKey of 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate?
The InChIKey is CXVZHVVEXHQZPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2Si/c1-14(2,3)9-8-13-10(12)11-6-4-5-7-11/h4,6H,5,7-9H2,1-3H3.
What are the key properties of 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate?
2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate has a molecular weight of 213.35 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2,3-dihydropyrrole-1-carboxylate is sourced from PubChem (CID 135085711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).