About chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene
chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene (PubChem CID 135085798) has the molecular formula C11H15ClZn
and a molecular weight of 248.08 g/mol. Its IUPAC name is chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene.
Molecular Properties
| Compound Name | chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene |
| PubChem CID | 135085798 |
| Molecular Formula | C11H15ClZn |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene |
| SMILES | Cl[Zn+].[C-]#CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C11H15.ClH.Zn/c1-5-10-9(2)7-6-8-11(10,3)4;;/h6-8H2,2-4H3;1H;/q-1;;+2/p-1 |
| InChIKey | FPDYSZPMAPBBKB-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene?
The IUPAC name of chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene (CID 135085798) is chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene.
What is the SMILES notation for chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene?
The canonical SMILES for chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene is Cl[Zn+].[C-]#CC1=C(C)CCCC1(C)C.
What is the InChIKey of chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene?
The InChIKey is FPDYSZPMAPBBKB-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H15.ClH.Zn/c1-5-10-9(2)7-6-8-11(10,3)4;;/h6-8H2,2-4H3;1H;/q-1;;+2/p-1.
What are the key properties of chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene?
chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene has a molecular weight of 248.08 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorozinc(1+);2-ethynyl-1,3,3-trimethylcyclohexene is sourced from PubChem (CID 135085798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).