C10H9NO2 — CID 135085831
5-phenyl-2,3-dihydro-1,4-oxazin-6-one (PubChem CID 135085831) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 5-phenyl-2,3-dihydro-1,4-oxazin-6-one.
| Compound Name | 5-phenyl-2,3-dihydro-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 135085831 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 5-phenyl-2,3-dihydro-1,4-oxazin-6-one |
| SMILES | O=C1OCCN=C1c1ccccc1 |
| InChI | InChI=1S/C10H9NO2/c12-10-9(11-6-7-13-10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | ZCGVWGQGUYQPIJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |