C13H20OSi — CID 135086220
7-triethylsilylhepta-4,6-diynal (PubChem CID 135086220) has the molecular formula C13H20OSi and a molecular weight of 220.39 g/mol. Its IUPAC name is 7-triethylsilylhepta-4,6-diynal.
| Compound Name | 7-triethylsilylhepta-4,6-diynal |
|---|---|
| PubChem CID | 135086220 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 7-triethylsilylhepta-4,6-diynal |
| SMILES | CC[Si](C#CC#CCCC=O)(CC)CC |
| InChI | InChI=1S/C13H20OSi/c1-4-15(5-2,6-3)13-11-9-7-8-10-12-14/h12H,4-6,8,10H2,1-3H3 |
| InChIKey | HTTPMVPPJZEAJR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|