C46H42Cl3NO9S — CID 135086494
[2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-3-phenylmethoxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate (PubChem CID 135086494) has the molecular formula C46H42Cl3NO9S and a molecular weight of 891.27 g/mol. Its IUPAC name is [2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-3-phenylmethoxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate.
| Compound Name | [2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-3-phenylmethoxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 135086494 |
| Molecular Formula | C46H42Cl3NO9S |
| Molecular Weight | 891.27 g/mol |
| Exact Mass | 889.16 |
| IUPAC Name | [2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-3-phenylmethoxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate |
| SMILES | [H]/N=C(/OC1OC(COC(=O)OCC2c3ccccc3-c3ccccc32)C(OCc2ccccc2)C(OC(C)=O)C1O[C@H](CSc1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C46H42Cl3NO9S/c1-29(51)56-41-40(53-25-30-15-5-2-6-16-30)38(27-55-45(52)54-26-37-35-23-13-11-21-33(35)34-22-12-14-24-36(34)37)58-43(59-44(50)46(47,48)49)42(41)57-39(31-17-7-3-8-18-31)28-60-32-19-9-4-10-20-32/h2-24,37-43,50H,25-28H2,1H3/b50-44+/t38?,39-,40?,41?,42?,43?/m1/s1 |
| InChIKey | LEWRECDRTNQAGH-MZJPYBDNSA-N |
| XLogP | 10.48 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.27 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|