C32H68O6Si3 — CID 135086556
(3R,4R,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]-6-(2-hydroxyethyl)oxan-2-ol (PubChem CID 135086556) has the molecular formula C32H68O6Si3 and a molecular weight of 633.15 g/mol. Its IUPAC name is (3R,4R,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]-6-(2-hydroxyethyl)oxan-2-ol.
| Compound Name | (3R,4R,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]-6-(2-hydroxyethyl)oxan-2-ol |
|---|---|
| PubChem CID | 135086556 |
| Molecular Formula | C32H68O6Si3 |
| Molecular Weight | 633.15 g/mol |
| Exact Mass | 632.43 |
| IUPAC Name | (3R,4R,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]-6-(2-hydroxyethyl)oxan-2-ol |
| SMILES | C[C@H](/C=C/C[C@H]1C(O)O[C@@H](CCO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H68O6Si3/c1-23(24(2)36-39(12,13)30(3,4)5)19-18-20-25-27(37-40(14,15)31(6,7)8)28(26(21-22-33)35-29(25)34)38-41(16,17)32(9,10)11/h18-19,23-29,33-34H,20-22H2,1-17H3/b19-18+/t23-,24+,25-,26+,27-,28+,29?/m1/s1 |
| InChIKey | BCUJCOZTADMHDY-HIZZSAPFSA-N |
| XLogP | 8.48 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.15 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|