C22H22O3 — CID 135086584
ethyl (2R)-1-oxo-2-[(1S)-1-phenylprop-2-enyl]-3,4-dihydronaphthalene-2-carboxylate (PubChem CID 135086584) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl (2R)-1-oxo-2-[(1S)-1-phenylprop-2-enyl]-3,4-dihydronaphthalene-2-carboxylate.
| Compound Name | ethyl (2R)-1-oxo-2-[(1S)-1-phenylprop-2-enyl]-3,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 135086584 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | ethyl (2R)-1-oxo-2-[(1S)-1-phenylprop-2-enyl]-3,4-dihydronaphthalene-2-carboxylate |
| SMILES | C=C[C@@H](c1ccccc1)[C@]1(C(=O)OCC)CCc2ccccc2C1=O |
| InChI | InChI=1S/C22H22O3/c1-3-19(17-11-6-5-7-12-17)22(21(24)25-4-2)15-14-16-10-8-9-13-18(16)20(22)23/h3,5-13,19H,1,4,14-15H2,2H3/t19-,22+/m0/s1 |
| InChIKey | LEKPZOQWWGOXTM-SIKLNZKXSA-N |
| XLogP | 4.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|