About N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide
N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide (PubChem CID 135087753) has the molecular formula C16H26N4O3S
and a molecular weight of 354.48 g/mol. Its IUPAC name is N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide.
Molecular Properties
| Compound Name | N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide |
| PubChem CID | 135087753 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide |
| SMILES | CSCc1noc(CNC(=O)CCC(=O)N(C)C2CCCCC2)n1 |
| InChI | InChI=1S/C16H26N4O3S/c1-20(12-6-4-3-5-7-12)16(22)9-8-14(21)17-10-15-18-13(11-24-2)19-23-15/h12H,3-11H2,1-2H3,(H,17,21) |
| InChIKey | JQJWNKFAISBRDI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide?
The IUPAC name of N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide (CID 135087753) is N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide.
What is the SMILES notation for N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide?
The canonical SMILES for N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide is CSCc1noc(CNC(=O)CCC(=O)N(C)C2CCCCC2)n1.
What is the InChIKey of N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide?
The InChIKey is JQJWNKFAISBRDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O3S/c1-20(12-6-4-3-5-7-12)16(22)9-8-14(21)17-10-15-18-13(11-24-2)19-23-15/h12H,3-11H2,1-2H3,(H,17,21).
What are the key properties of N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide?
N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide has a molecular weight of 354.48 g/mol, XLogP of 2.12, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclohexyl-N'-methyl-N-[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]butanediamide is sourced from PubChem (CID 135087753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).