C17H26N2O3S — CID 135087760
[(4aS,8aS)-7-[2-(benzenesulfonyl)ethyl]-1,2,3,4,5,6,8,8a-octahydro-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135087760) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is [(4aS,8aS)-7-[2-(benzenesulfonyl)ethyl]-1,2,3,4,5,6,8,8a-octahydro-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-7-[2-(benzenesulfonyl)ethyl]-1,2,3,4,5,6,8,8a-octahydro-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135087760 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [(4aS,8aS)-7-[2-(benzenesulfonyl)ethyl]-1,2,3,4,5,6,8,8a-octahydro-1,7-naphthyridin-4a-yl]methanol |
| SMILES | O=S(=O)(CCN1CC[C@@]2(CO)CCCN[C@@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O3S/c20-14-17-7-4-9-18-16(17)13-19(10-8-17)11-12-23(21,22)15-5-2-1-3-6-15/h1-3,5-6,16,18,20H,4,7-14H2/t16-,17-/m1/s1 |
| InChIKey | WTTXDLFKQOPOIR-IAGOWNOFSA-N |
| XLogP | 0.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |