C15H13F4NO4 — CID 135088869
(1R,5S)-3-[(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid (PubChem CID 135088869) has the molecular formula C15H13F4NO4 and a molecular weight of 347.26 g/mol. Its IUPAC name is (1R,5S)-3-[(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid.
| Compound Name | (1R,5S)-3-[(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid |
|---|---|
| PubChem CID | 135088869 |
| Molecular Formula | C15H13F4NO4 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (1R,5S)-3-[(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid |
| SMILES | Cc1c(F)c(F)c(CN2C[C@@]3(C(=O)O)C[C@@]3(C(=O)O)C2)c(F)c1F |
| InChI | InChI=1S/C15H13F4NO4/c1-6-8(16)10(18)7(11(19)9(6)17)2-20-4-14(12(21)22)3-15(14,5-20)13(23)24/h2-5H2,1H3,(H,21,22)(H,23,24)/t14-,15+ |
| InChIKey | CCCADRYCASHNHT-GASCZTMLSA-N |
| XLogP | 1.91 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|