C18H25NO2S — CID 135089383
3-[5-[[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol (PubChem CID 135089383) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is 3-[5-[[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 135089383 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-[5-[[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol |
| SMILES | CO[C@@H]1CCC[C@@]12CCCN(Cc1ccc(C#CCO)s1)C2 |
| InChI | InChI=1S/C18H25NO2S/c1-21-17-6-2-9-18(17)10-4-11-19(14-18)13-16-8-7-15(22-16)5-3-12-20/h7-8,17,20H,2,4,6,9-14H2,1H3/t17-,18+/m1/s1 |
| InChIKey | LZUUYOIFNLKMNN-MSOLQXFVSA-N |
| XLogP | 2.87 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|