C19H26N4O3 — CID 135090545
N-(2-ethylphenyl)-N'-(2-hydroxyethyl)-N'-[(2-methyl-1H-imidazol-5-yl)methyl]butanediamide (PubChem CID 135090545) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(2-ethylphenyl)-N'-(2-hydroxyethyl)-N'-[(2-methyl-1H-imidazol-5-yl)methyl]butanediamide.
| Compound Name | N-(2-ethylphenyl)-N'-(2-hydroxyethyl)-N'-[(2-methyl-1H-imidazol-5-yl)methyl]butanediamide |
|---|---|
| PubChem CID | 135090545 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-(2-ethylphenyl)-N'-(2-hydroxyethyl)-N'-[(2-methyl-1H-imidazol-5-yl)methyl]butanediamide |
| SMILES | CCc1ccccc1NC(=O)CCC(=O)N(CCO)Cc1cnc(C)[nH]1 |
| InChI | InChI=1S/C19H26N4O3/c1-3-15-6-4-5-7-17(15)22-18(25)8-9-19(26)23(10-11-24)13-16-12-20-14(2)21-16/h4-7,12,24H,3,8-11,13H2,1-2H3,(H,20,21)(H,22,25) |
| InChIKey | GNNLWEOTJATLTL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |