C21H29N3O5S — CID 135090808
1-cyclopentyl-N-[[(1S,5S,6R,7R)-3-(6-oxo-1H-pyridine-2-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]methanesulfonamide (PubChem CID 135090808) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-cyclopentyl-N-[[(1S,5S,6R,7R)-3-(6-oxo-1H-pyridine-2-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]methanesulfonamide.
| Compound Name | 1-cyclopentyl-N-[[(1S,5S,6R,7R)-3-(6-oxo-1H-pyridine-2-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 135090808 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-cyclopentyl-N-[[(1S,5S,6R,7R)-3-(6-oxo-1H-pyridine-2-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]methanesulfonamide |
| SMILES | O=C(c1cccc(=O)[nH]1)N1C[C@@H]2[C@H](CNS(=O)(=O)CC3CCCC3)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C21H29N3O5S/c25-19-7-3-6-17(23-19)20(26)24-11-16-15(18-8-9-21(16,13-24)29-18)10-22-30(27,28)12-14-4-1-2-5-14/h3,6-7,14-16,18,22H,1-2,4-5,8-13H2,(H,23,25)/t15-,16+,18+,21+/m0/s1 |
| InChIKey | RXULLHFQUDJTIA-LTVCHDBBSA-N |
| XLogP | 1.10 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |