C15H21F3N4O — CID 135091833
[(4aS,8aS)-1-methyl-7-[4-(trifluoromethyl)pyrimidin-2-yl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135091833) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-[4-(trifluoromethyl)pyrimidin-2-yl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-[4-(trifluoromethyl)pyrimidin-2-yl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135091833 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-[4-(trifluoromethyl)pyrimidin-2-yl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CN1CCC[C@]2(CO)CCN(c3nccc(C(F)(F)F)n3)C[C@@H]12 |
| InChI | InChI=1S/C15H21F3N4O/c1-21-7-2-4-14(10-23)5-8-22(9-12(14)21)13-19-6-3-11(20-13)15(16,17)18/h3,6,12,23H,2,4-5,7-10H2,1H3/t12-,14-/m1/s1 |
| InChIKey | UYCGUFVRTWQQSY-TZMCWYRMSA-N |
| XLogP | 1.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |