C23H27FN4O4 — CID 135092968
N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-6-fluoro-N-methyl-7-morpholin-4-yl-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 135092968) has the molecular formula C23H27FN4O4 and a molecular weight of 442.49 g/mol. Its IUPAC name is N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-6-fluoro-N-methyl-7-morpholin-4-yl-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-6-fluoro-N-methyl-7-morpholin-4-yl-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 135092968 |
| Molecular Formula | C23H27FN4O4 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-6-fluoro-N-methyl-7-morpholin-4-yl-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CN(C(=O)c1c[nH]c2cc(N3CCOCC3)c(F)cc2c1=O)[C@H]1C[C@H]2CNC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C23H27FN4O4/c1-27(15-6-13-8-21(29)26-11-14(13)7-15)23(31)17-12-25-19-10-20(28-2-4-32-5-3-28)18(24)9-16(19)22(17)30/h9-10,12-15H,2-8,11H2,1H3,(H,25,30)(H,26,29)/t13-,14+,15-/m1/s1 |
| InChIKey | DMGZUROZDAOQLY-QLFBSQMISA-N |
| XLogP | 1.49 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |