C16H23N5O3 — CID 135092980
2-[4-[[6-(pyrrolidine-1-carbonyl)pyrazin-2-yl]amino]piperidin-1-yl]acetic acid (PubChem CID 135092980) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[4-[[6-(pyrrolidine-1-carbonyl)pyrazin-2-yl]amino]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[6-(pyrrolidine-1-carbonyl)pyrazin-2-yl]amino]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 135092980 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-[4-[[6-(pyrrolidine-1-carbonyl)pyrazin-2-yl]amino]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(Nc2cncc(C(=O)N3CCCC3)n2)CC1 |
| InChI | InChI=1S/C16H23N5O3/c22-15(23)11-20-7-3-12(4-8-20)18-14-10-17-9-13(19-14)16(24)21-5-1-2-6-21/h9-10,12H,1-8,11H2,(H,18,19)(H,22,23) |
| InChIKey | MLXSCSSSAUNMNT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |