C17H20ClN3O2 — CID 135093304
(1S,5R)-7-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 135093304) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is (1S,5R)-7-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | (1S,5R)-7-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 135093304 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (1S,5R)-7-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | Cc1c(CN2C[C@H]3COC[C@@H](C2)C(=O)N3)[nH]c2c(Cl)cccc12 |
| InChI | InChI=1S/C17H20ClN3O2/c1-10-13-3-2-4-14(18)16(13)20-15(10)7-21-5-11-8-23-9-12(6-21)19-17(11)22/h2-4,11-12,20H,5-9H2,1H3,(H,19,22)/t11-,12+/m1/s1 |
| InChIKey | RZZLQYILEQMLIT-NEPJUHHUSA-N |
| XLogP | 2.08 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|