C15H25N5OS — CID 135093502
[(4aS,8aS)-7-(6-amino-2-methylsulfanylpyrimidin-4-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135093502) has the molecular formula C15H25N5OS and a molecular weight of 323.47 g/mol. Its IUPAC name is [(4aS,8aS)-7-(6-amino-2-methylsulfanylpyrimidin-4-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-7-(6-amino-2-methylsulfanylpyrimidin-4-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135093502 |
| Molecular Formula | C15H25N5OS |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | [(4aS,8aS)-7-(6-amino-2-methylsulfanylpyrimidin-4-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CSc1nc(N)cc(N2CC[C@@]3(CO)CCCN(C)[C@@H]3C2)n1 |
| InChI | InChI=1S/C15H25N5OS/c1-19-6-3-4-15(10-21)5-7-20(9-11(15)19)13-8-12(16)17-14(18-13)22-2/h8,11,21H,3-7,9-10H2,1-2H3,(H2,16,17,18)/t11-,15-/m1/s1 |
| InChIKey | BBKSTIQHXWFQIQ-IAQYHMDHSA-N |
| XLogP | 1.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |