C19H24ClN3O — CID 135093568
[(4aS,8aS)-7-(6-chloroquinolin-4-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135093568) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is [(4aS,8aS)-7-(6-chloroquinolin-4-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-7-(6-chloroquinolin-4-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135093568 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [(4aS,8aS)-7-(6-chloroquinolin-4-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CN1CCC[C@]2(CO)CCN(c3ccnc4ccc(Cl)cc34)C[C@@H]12 |
| InChI | InChI=1S/C19H24ClN3O/c1-22-9-2-6-19(13-24)7-10-23(12-18(19)22)17-5-8-21-16-4-3-14(20)11-15(16)17/h3-5,8,11,18,24H,2,6-7,9-10,12-13H2,1H3/t18-,19-/m1/s1 |
| InChIKey | UVQQSGAHXGYMNG-RTBURBONSA-N |
| XLogP | 3.17 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |