About 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide
1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide (PubChem CID 135093627) has the molecular formula C15H23N3O4S
and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide |
| PubChem CID | 135093627 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@H]1NC(=O)c1cccn1C1CC1 |
| InChI | InChI=1S/C15H23N3O4S/c1-17(2)23(20,21)10-11-8-22-9-13(11)16-15(19)14-4-3-7-18(14)12-5-6-12/h3-4,7,11-13H,5-6,8-10H2,1-2H3,(H,16,19)/t11-,13+/m0/s1 |
| InChIKey | ZQSHGEAZBQCFRF-WCQYABFASA-N |
| XLogP | 0.46 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide?
The IUPAC name of 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide (CID 135093627) is 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide.
What is the SMILES notation for 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide?
The canonical SMILES for 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide is CN(C)S(=O)(=O)C[C@@H]1COC[C@H]1NC(=O)c1cccn1C1CC1.
What is the InChIKey of 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide?
The InChIKey is ZQSHGEAZBQCFRF-WCQYABFASA-N. The full InChI is InChI=1S/C15H23N3O4S/c1-17(2)23(20,21)10-11-8-22-9-13(11)16-15(19)14-4-3-7-18(14)12-5-6-12/h3-4,7,11-13H,5-6,8-10H2,1-2H3,(H,16,19)/t11-,13+/m0/s1.
What are the key properties of 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide?
1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide has a molecular weight of 341.43 g/mol, XLogP of 0.46, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]pyrrole-2-carboxamide is sourced from PubChem (CID 135093627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).