C17H25N3O2 — CID 135093749
(4aR,6R,7aR)-6-[(6-ethoxy-3-pyridinyl)methyl-methylamino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one (PubChem CID 135093749) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (4aR,6R,7aR)-6-[(6-ethoxy-3-pyridinyl)methyl-methylamino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one.
| Compound Name | (4aR,6R,7aR)-6-[(6-ethoxy-3-pyridinyl)methyl-methylamino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 135093749 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (4aR,6R,7aR)-6-[(6-ethoxy-3-pyridinyl)methyl-methylamino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one |
| SMILES | CCOc1ccc(CN(C)[C@H]2C[C@H]3CNC(=O)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-22-17-5-4-12(9-19-17)11-20(2)15-6-13-8-16(21)18-10-14(13)7-15/h4-5,9,13-15H,3,6-8,10-11H2,1-2H3,(H,18,21)/t13-,14+,15-/m1/s1 |
| InChIKey | YYQSELXWLSWOHW-QLFBSQMISA-N |
| XLogP | 1.83 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |