C22H24N2O3 — CID 135094364
(1S,5R)-7-(3,3-diphenylpropanoyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 135094364) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is (1S,5R)-7-(3,3-diphenylpropanoyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | (1S,5R)-7-(3,3-diphenylpropanoyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 135094364 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (1S,5R)-7-(3,3-diphenylpropanoyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | O=C1N[C@@H]2COC[C@H]1CN(C(=O)CC(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C22H24N2O3/c25-21(24-12-18-14-27-15-19(13-24)23-22(18)26)11-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18-20H,11-15H2,(H,23,26)/t18-,19+/m1/s1 |
| InChIKey | RVPRGJDFFSFYPY-MOPGFXCFSA-N |
| XLogP | 2.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |