C16H22N6O2 — CID 135094995
[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone (PubChem CID 135094995) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone.
| Compound Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 135094995 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone |
| SMILES | CN1CCC[C@]2(CO)CCN(C(=O)c3nc4ncccn4n3)C[C@@H]12 |
| InChI | InChI=1S/C16H22N6O2/c1-20-7-2-4-16(11-23)5-9-21(10-12(16)20)14(24)13-18-15-17-6-3-8-22(15)19-13/h3,6,8,12,23H,2,4-5,7,9-11H2,1H3/t12-,16-/m1/s1 |
| InChIKey | BQCBGIQHCGTYEP-MLGOLLRUSA-N |
| XLogP | 0.04 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |