C20H28N4O3S — CID 135095384
[(4aS,8aS)-1-methyl-7-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135095384) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135095384 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | Cc1ccc(-n2cccn2)cc1S(=O)(=O)N1CC[C@@]2(CO)CCCN(C)[C@@H]2C1 |
| InChI | InChI=1S/C20H28N4O3S/c1-16-5-6-17(24-11-4-9-21-24)13-18(16)28(26,27)23-12-8-20(15-25)7-3-10-22(2)19(20)14-23/h4-6,9,11,13,19,25H,3,7-8,10,12,14-15H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | MTSLPLWLARIQJO-WOJBJXKFSA-N |
| XLogP | 1.65 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |