C19H23N5O — CID 135095968
4-N,4-N,5-trimethyl-2-N-[2-(2-methylquinolin-8-yl)oxyethyl]pyrimidine-2,4-diamine (PubChem CID 135095968) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-N,4-N,5-trimethyl-2-N-[2-(2-methylquinolin-8-yl)oxyethyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N,4-N,5-trimethyl-2-N-[2-(2-methylquinolin-8-yl)oxyethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 135095968 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-N,4-N,5-trimethyl-2-N-[2-(2-methylquinolin-8-yl)oxyethyl]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc2cccc(OCCNc3ncc(C)c(N(C)C)n3)c2n1 |
| InChI | InChI=1S/C19H23N5O/c1-13-12-21-19(23-18(13)24(3)4)20-10-11-25-16-7-5-6-15-9-8-14(2)22-17(15)16/h5-9,12H,10-11H2,1-4H3,(H,20,21,23) |
| InChIKey | KMKUUDMGAPWNIO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|