C21H26N2O2 — CID 135096331
(4aR,6R,7aR)-6-[methyl-[[4-(5-methylfuran-2-yl)phenyl]methyl]amino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one (PubChem CID 135096331) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (4aR,6R,7aR)-6-[methyl-[[4-(5-methylfuran-2-yl)phenyl]methyl]amino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one.
| Compound Name | (4aR,6R,7aR)-6-[methyl-[[4-(5-methylfuran-2-yl)phenyl]methyl]amino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 135096331 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (4aR,6R,7aR)-6-[methyl-[[4-(5-methylfuran-2-yl)phenyl]methyl]amino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one |
| SMILES | Cc1ccc(-c2ccc(CN(C)[C@H]3C[C@H]4CNC(=O)C[C@H]4C3)cc2)o1 |
| InChI | InChI=1S/C21H26N2O2/c1-14-3-8-20(25-14)16-6-4-15(5-7-16)13-23(2)19-9-17-11-21(24)22-12-18(17)10-19/h3-8,17-19H,9-13H2,1-2H3,(H,22,24)/t17-,18+,19-/m1/s1 |
| InChIKey | NGKGVIHQTAKUCA-CEXWTWQISA-N |
| XLogP | 3.60 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |