C16H25N3OS — CID 135096513
(4aR,6R,7aR)-6-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one (PubChem CID 135096513) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is (4aR,6R,7aR)-6-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one.
| Compound Name | (4aR,6R,7aR)-6-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 135096513 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (4aR,6R,7aR)-6-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
| SMILES | Cc1nc(CN(C)[C@@H]2C[C@@H]3CC(=O)N(C)C[C@@H]3C2)sc1C |
| InChI | InChI=1S/C16H25N3OS/c1-10-11(2)21-15(17-10)9-18(3)14-5-12-7-16(20)19(4)8-13(12)6-14/h12-14H,5-9H2,1-4H3/t12-,13+,14-/m1/s1 |
| InChIKey | BKDSTDDPNPRVHE-HZSPNIEDSA-N |
| XLogP | 2.45 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |