C15H17ClN4O — CID 135096791
1-(5-chloro-2-methylpyrimidin-4-yl)-4-pyridin-3-ylpiperidin-4-ol (PubChem CID 135096791) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methylpyrimidin-4-yl)-4-pyridin-3-ylpiperidin-4-ol.
| Compound Name | 1-(5-chloro-2-methylpyrimidin-4-yl)-4-pyridin-3-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 135096791 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-(5-chloro-2-methylpyrimidin-4-yl)-4-pyridin-3-ylpiperidin-4-ol |
| SMILES | Cc1ncc(Cl)c(N2CCC(O)(c3cccnc3)CC2)n1 |
| InChI | InChI=1S/C15H17ClN4O/c1-11-18-10-13(16)14(19-11)20-7-4-15(21,5-8-20)12-3-2-6-17-9-12/h2-3,6,9-10,21H,4-5,7-8H2,1H3 |
| InChIKey | LWHMAGVMRDZFDB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |