C19H23N3O3 — CID 135096905
[(3R,4R)-3-hydroxy-4-[(5-methyl-1H-pyrazol-3-yl)methyl]pyrrolidin-1-yl]-(2-prop-2-enoxyphenyl)methanone (PubChem CID 135096905) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(3R,4R)-3-hydroxy-4-[(5-methyl-1H-pyrazol-3-yl)methyl]pyrrolidin-1-yl]-(2-prop-2-enoxyphenyl)methanone.
| Compound Name | [(3R,4R)-3-hydroxy-4-[(5-methyl-1H-pyrazol-3-yl)methyl]pyrrolidin-1-yl]-(2-prop-2-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 135096905 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [(3R,4R)-3-hydroxy-4-[(5-methyl-1H-pyrazol-3-yl)methyl]pyrrolidin-1-yl]-(2-prop-2-enoxyphenyl)methanone |
| SMILES | C=CCOc1ccccc1C(=O)N1C[C@@H](Cc2cc(C)[nH]n2)[C@@H](O)C1 |
| InChI | InChI=1S/C19H23N3O3/c1-3-8-25-18-7-5-4-6-16(18)19(24)22-11-14(17(23)12-22)10-15-9-13(2)20-21-15/h3-7,9,14,17,23H,1,8,10-12H2,2H3,(H,20,21)/t14-,17+/m1/s1 |
| InChIKey | QSQGSYIIOPTCMN-PBHICJAKSA-N |
| XLogP | 1.96 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|