C15H18FN5O2 — CID 135098500
[1-(5-fluoro-4-methoxypyrimidin-2-yl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone (PubChem CID 135098500) has the molecular formula C15H18FN5O2 and a molecular weight of 319.34 g/mol. Its IUPAC name is [1-(5-fluoro-4-methoxypyrimidin-2-yl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone.
| Compound Name | [1-(5-fluoro-4-methoxypyrimidin-2-yl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 135098500 |
| Molecular Formula | C15H18FN5O2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [1-(5-fluoro-4-methoxypyrimidin-2-yl)piperidin-3-yl]-(1-methylimidazol-2-yl)methanone |
| SMILES | COc1nc(N2CCCC(C(=O)c3nccn3C)C2)ncc1F |
| InChI | InChI=1S/C15H18FN5O2/c1-20-7-5-17-13(20)12(22)10-4-3-6-21(9-10)15-18-8-11(16)14(19-15)23-2/h5,7-8,10H,3-4,6,9H2,1-2H3 |
| InChIKey | BGFMQWZWXFUWQO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |