C22H24F3NO — CID 135099951
(3aR,4R,7aS)-4-phenyl-2-[[2-(trifluoromethyl)phenyl]methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 135099951) has the molecular formula C22H24F3NO and a molecular weight of 375.43 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-phenyl-2-[[2-(trifluoromethyl)phenyl]methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aR,4R,7aS)-4-phenyl-2-[[2-(trifluoromethyl)phenyl]methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 135099951 |
| Molecular Formula | C22H24F3NO |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (3aR,4R,7aS)-4-phenyl-2-[[2-(trifluoromethyl)phenyl]methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | O[C@]1(c2ccccc2)CCC[C@@H]2CN(Cc3ccccc3C(F)(F)F)C[C@@H]21 |
| InChI | InChI=1S/C22H24F3NO/c23-22(24,25)19-11-5-4-7-16(19)13-26-14-17-8-6-12-21(27,20(17)15-26)18-9-2-1-3-10-18/h1-5,7,9-11,17,20,27H,6,8,12-15H2/t17-,20+,21+/m1/s1 |
| InChIKey | HWKYULXKTMAQAB-QMMLZNLJSA-N |
| XLogP | 4.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |