C12H16FN7 — CID 135105424
2-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-fluoro-4-N,4-N-dimethylpyrimidine-2,4-diamine (PubChem CID 135105424) has the molecular formula C12H16FN7 and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-fluoro-4-N,4-N-dimethylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-fluoro-4-N,4-N-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 135105424 |
| Molecular Formula | C12H16FN7 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-fluoro-4-N,4-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1nc(NCc2nnc3n2CCC3)ncc1F |
| InChI | InChI=1S/C12H16FN7/c1-19(2)11-8(13)6-14-12(16-11)15-7-10-18-17-9-4-3-5-20(9)10/h6H,3-5,7H2,1-2H3,(H,14,15,16) |
| InChIKey | UHWWLXFKTXNRJL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |