C16H23N3OS — CID 135106200
[1-[(1-ethylpyrazol-3-yl)methyl]piperidin-4-yl]-thiophen-2-ylmethanol (PubChem CID 135106200) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is [1-[(1-ethylpyrazol-3-yl)methyl]piperidin-4-yl]-thiophen-2-ylmethanol.
| Compound Name | [1-[(1-ethylpyrazol-3-yl)methyl]piperidin-4-yl]-thiophen-2-ylmethanol |
|---|---|
| PubChem CID | 135106200 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [1-[(1-ethylpyrazol-3-yl)methyl]piperidin-4-yl]-thiophen-2-ylmethanol |
| SMILES | CCn1ccc(CN2CCC(C(O)c3cccs3)CC2)n1 |
| InChI | InChI=1S/C16H23N3OS/c1-2-19-10-7-14(17-19)12-18-8-5-13(6-9-18)16(20)15-4-3-11-21-15/h3-4,7,10-11,13,16,20H,2,5-6,8-9,12H2,1H3 |
| InChIKey | WXENALKLVIJDNA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |