About 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol
2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol (PubChem CID 135106583) has the molecular formula C16H22FN3O3
and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol |
| PubChem CID | 135106583 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol |
| SMILES | COc1cc(F)c(CN(CCO)Cc2cnc(C)[nH]2)cc1OC |
| InChI | InChI=1S/C16H22FN3O3/c1-11-18-8-13(19-11)10-20(4-5-21)9-12-6-15(22-2)16(23-3)7-14(12)17/h6-8,21H,4-5,9-10H2,1-3H3,(H,18,19) |
| InChIKey | HPRPNSKSSVHJKH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol?
The IUPAC name of 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol (CID 135106583) is 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol.
What is the SMILES notation for 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol?
The canonical SMILES for 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol is COc1cc(F)c(CN(CCO)Cc2cnc(C)[nH]2)cc1OC.
What is the InChIKey of 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol?
The InChIKey is HPRPNSKSSVHJKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FN3O3/c1-11-18-8-13(19-11)10-20(4-5-21)9-12-6-15(22-2)16(23-3)7-14(12)17/h6-8,21H,4-5,9-10H2,1-3H3,(H,18,19).
What are the key properties of 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol?
2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol has a molecular weight of 323.37 g/mol, XLogP of 1.87, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-fluoro-4,5-dimethoxyphenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol is sourced from PubChem (CID 135106583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).