C19H23NO4 — CID 135108076
(3R,4S)-4-benzyl-1-(cyclopent-3-ene-1-carbonyl)-3-hydroxypiperidine-4-carboxylic acid (PubChem CID 135108076) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3R,4S)-4-benzyl-1-(cyclopent-3-ene-1-carbonyl)-3-hydroxypiperidine-4-carboxylic acid.
| Compound Name | (3R,4S)-4-benzyl-1-(cyclopent-3-ene-1-carbonyl)-3-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135108076 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (3R,4S)-4-benzyl-1-(cyclopent-3-ene-1-carbonyl)-3-hydroxypiperidine-4-carboxylic acid |
| SMILES | O=C(C1CC=CC1)N1CC[C@](Cc2ccccc2)(C(=O)O)[C@@H](O)C1 |
| InChI | InChI=1S/C19H23NO4/c21-16-13-20(17(22)15-8-4-5-9-15)11-10-19(16,18(23)24)12-14-6-2-1-3-7-14/h1-7,15-16,21H,8-13H2,(H,23,24)/t16-,19+/m0/s1 |
| InChIKey | PIDZYVHBRBCFMP-QFBILLFUSA-N |
| XLogP | 1.86 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|