C16H17ClN4O — CID 135108946
1-[4-[[(5-chloro-2-methylpyrimidin-4-yl)amino]methyl]phenyl]pyrrolidin-2-one (PubChem CID 135108946) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 1-[4-[[(5-chloro-2-methylpyrimidin-4-yl)amino]methyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[[(5-chloro-2-methylpyrimidin-4-yl)amino]methyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 135108946 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-[4-[[(5-chloro-2-methylpyrimidin-4-yl)amino]methyl]phenyl]pyrrolidin-2-one |
| SMILES | Cc1ncc(Cl)c(NCc2ccc(N3CCCC3=O)cc2)n1 |
| InChI | InChI=1S/C16H17ClN4O/c1-11-18-10-14(17)16(20-11)19-9-12-4-6-13(7-5-12)21-8-2-3-15(21)22/h4-7,10H,2-3,8-9H2,1H3,(H,18,19,20) |
| InChIKey | LDHZMJMRDRAXHL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |