C20H25N5O3 — CID 135109084
4-[4-[4-(3-hydroxypiperidin-1-yl)pyrimidin-2-yl]piperazin-1-yl]benzoic acid (PubChem CID 135109084) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[4-[4-(3-hydroxypiperidin-1-yl)pyrimidin-2-yl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[4-(3-hydroxypiperidin-1-yl)pyrimidin-2-yl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 135109084 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-[4-[4-(3-hydroxypiperidin-1-yl)pyrimidin-2-yl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(c3nccc(N4CCCC(O)C4)n3)CC2)cc1 |
| InChI | InChI=1S/C20H25N5O3/c26-17-2-1-9-25(14-17)18-7-8-21-20(22-18)24-12-10-23(11-13-24)16-5-3-15(4-6-16)19(27)28/h3-8,17,26H,1-2,9-14H2,(H,27,28) |
| InChIKey | PBLGLXPRSVZHIG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |