C20H21F3N4O2 — CID 135110183
1,3-dimethyl-8-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 135110183) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is 1,3-dimethyl-8-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1,3-dimethyl-8-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 135110183 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1,3-dimethyl-8-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(N2CCC3(CC2)C(=O)N(C)C(=O)N3C)c2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C20H21F3N4O2/c1-12-10-16(14-5-4-13(20(21,22)23)11-15(14)24-12)27-8-6-19(7-9-27)17(28)25(2)18(29)26(19)3/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | PZOYIWAZFUIECF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|