C16H17FN4O — CID 135110530
3-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-5-propan-2-yl-1,2,4-oxadiazole (PubChem CID 135110530) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-5-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-5-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 135110530 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-5-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1nc(N2CCc3[nH]c4ccc(F)cc4c3C2)no1 |
| InChI | InChI=1S/C16H17FN4O/c1-9(2)15-19-16(20-22-15)21-6-5-14-12(8-21)11-7-10(17)3-4-13(11)18-14/h3-4,7,9,18H,5-6,8H2,1-2H3 |
| InChIKey | FXLRDRHLEZBTPQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|