C18H26N4O — CID 135110911
N-(3,3-dimethyl-1-pyridin-3-ylbutyl)-4-pyrazol-1-ylbutanamide (PubChem CID 135110911) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-pyridin-3-ylbutyl)-4-pyrazol-1-ylbutanamide.
| Compound Name | N-(3,3-dimethyl-1-pyridin-3-ylbutyl)-4-pyrazol-1-ylbutanamide |
|---|---|
| PubChem CID | 135110911 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N-(3,3-dimethyl-1-pyridin-3-ylbutyl)-4-pyrazol-1-ylbutanamide |
| SMILES | CC(C)(C)CC(NC(=O)CCCn1cccn1)c1cccnc1 |
| InChI | InChI=1S/C18H26N4O/c1-18(2,3)13-16(15-7-4-9-19-14-15)21-17(23)8-5-11-22-12-6-10-20-22/h4,6-7,9-10,12,14,16H,5,8,11,13H2,1-3H3,(H,21,23) |
| InChIKey | RKKYSUNYKJLHCH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |