C18H30N4O — CID 135111634
[(4aS,8aS)-1-methyl-7-[(2-propan-2-ylpyrimidin-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135111634) has the molecular formula C18H30N4O and a molecular weight of 318.46 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-[(2-propan-2-ylpyrimidin-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-[(2-propan-2-ylpyrimidin-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135111634 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-[(2-propan-2-ylpyrimidin-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CC(C)c1nccc(CN2CC[C@@]3(CO)CCCN(C)[C@@H]3C2)n1 |
| InChI | InChI=1S/C18H30N4O/c1-14(2)17-19-8-5-15(20-17)11-22-10-7-18(13-23)6-4-9-21(3)16(18)12-22/h5,8,14,16,23H,4,6-7,9-13H2,1-3H3/t16-,18-/m1/s1 |
| InChIKey | NOQCKJCPSKZEAE-SJLPKXTDSA-N |
| XLogP | 1.88 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |