C28H34N4O4 — CID 135112152
(1S,13S)-2-benzoyl-6-(2,3-dihydro-1-benzofuran-5-carbonyl)-2,6,11,14-tetrazabicyclo[11.2.1]hexadecan-12-one (PubChem CID 135112152) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is (1S,13S)-2-benzoyl-6-(2,3-dihydro-1-benzofuran-5-carbonyl)-2,6,11,14-tetrazabicyclo[11.2.1]hexadecan-12-one.
| Compound Name | (1S,13S)-2-benzoyl-6-(2,3-dihydro-1-benzofuran-5-carbonyl)-2,6,11,14-tetrazabicyclo[11.2.1]hexadecan-12-one |
|---|---|
| PubChem CID | 135112152 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | (1S,13S)-2-benzoyl-6-(2,3-dihydro-1-benzofuran-5-carbonyl)-2,6,11,14-tetrazabicyclo[11.2.1]hexadecan-12-one |
| SMILES | O=C1NCCCCN(C(=O)c2ccc3c(c2)CCO3)CCCN(C(=O)c2ccccc2)[C@@H]2CN[C@H]1C2 |
| InChI | InChI=1S/C28H34N4O4/c33-26-24-18-23(19-30-24)32(28(35)20-7-2-1-3-8-20)15-6-14-31(13-5-4-12-29-26)27(34)22-9-10-25-21(17-22)11-16-36-25/h1-3,7-10,17,23-24,30H,4-6,11-16,18-19H2,(H,29,33)/t23-,24-/m0/s1 |
| InChIKey | AMKYOFZEGIYZSK-ZEQRLZLVSA-N |
| XLogP | 2.24 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |