C17H22Cl2N2O2 — CID 135112734
(4R,5R)-N-(2,4-dichlorophenyl)-4-methoxy-7-azaspiro[4.5]decane-7-carboxamide (PubChem CID 135112734) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is (4R,5R)-N-(2,4-dichlorophenyl)-4-methoxy-7-azaspiro[4.5]decane-7-carboxamide.
| Compound Name | (4R,5R)-N-(2,4-dichlorophenyl)-4-methoxy-7-azaspiro[4.5]decane-7-carboxamide |
|---|---|
| PubChem CID | 135112734 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (4R,5R)-N-(2,4-dichlorophenyl)-4-methoxy-7-azaspiro[4.5]decane-7-carboxamide |
| SMILES | CO[C@@H]1CCC[C@]12CCCN(C(=O)Nc1ccc(Cl)cc1Cl)C2 |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-23-15-4-2-7-17(15)8-3-9-21(11-17)16(22)20-14-6-5-12(18)10-13(14)19/h5-6,10,15H,2-4,7-9,11H2,1H3,(H,20,22)/t15-,17-/m1/s1 |
| InChIKey | QKHDQKWIINRRCM-NVXWUHKLSA-N |
| XLogP | 4.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |