C18H23ClN4 — CID 135114553
5-chloro-2-methyl-N-[[1-[(2-methylphenyl)methyl]pyrrolidin-3-yl]methyl]pyrimidin-4-amine (PubChem CID 135114553) has the molecular formula C18H23ClN4 and a molecular weight of 330.86 g/mol. Its IUPAC name is 5-chloro-2-methyl-N-[[1-[(2-methylphenyl)methyl]pyrrolidin-3-yl]methyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-2-methyl-N-[[1-[(2-methylphenyl)methyl]pyrrolidin-3-yl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 135114553 |
| Molecular Formula | C18H23ClN4 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 5-chloro-2-methyl-N-[[1-[(2-methylphenyl)methyl]pyrrolidin-3-yl]methyl]pyrimidin-4-amine |
| SMILES | Cc1ncc(Cl)c(NCC2CCN(Cc3ccccc3C)C2)n1 |
| InChI | InChI=1S/C18H23ClN4/c1-13-5-3-4-6-16(13)12-23-8-7-15(11-23)9-21-18-17(19)10-20-14(2)22-18/h3-6,10,15H,7-9,11-12H2,1-2H3,(H,20,21,22) |
| InChIKey | XZLSHEJFTGRHAT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |