C37H44N6O7 — CID 135114641
(3S,6S)-5-(2-indazol-2-ylacetyl)-23-methoxy-13-(3-methylfuran-2-carbonyl)-2-oxa-5,8,13,17-tetrazatricyclo[19.2.2.13,6]hexacosa-1(23),21,24-triene-7,18-dione (PubChem CID 135114641) has the molecular formula C37H44N6O7 and a molecular weight of 684.79 g/mol. Its IUPAC name is (3S,6S)-5-(2-indazol-2-ylacetyl)-23-methoxy-13-(3-methylfuran-2-carbonyl)-2-oxa-5,8,13,17-tetrazatricyclo[19.2.2.13,6]hexacosa-1(23),21,24-triene-7,18-dione.
| Compound Name | (3S,6S)-5-(2-indazol-2-ylacetyl)-23-methoxy-13-(3-methylfuran-2-carbonyl)-2-oxa-5,8,13,17-tetrazatricyclo[19.2.2.13,6]hexacosa-1(23),21,24-triene-7,18-dione |
|---|---|
| PubChem CID | 135114641 |
| Molecular Formula | C37H44N6O7 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | (3S,6S)-5-(2-indazol-2-ylacetyl)-23-methoxy-13-(3-methylfuran-2-carbonyl)-2-oxa-5,8,13,17-tetrazatricyclo[19.2.2.13,6]hexacosa-1(23),21,24-triene-7,18-dione |
| SMILES | COc1cc2ccc1O[C@H]1C[C@@H](C(=O)NCCCCN(C(=O)c3occc3C)CCCNC(=O)CC2)N(C(=O)Cn2cc3ccccc3n2)C1 |
| InChI | InChI=1S/C37H44N6O7/c1-25-14-19-49-35(25)37(47)41-17-6-5-15-39-36(46)30-21-28(23-43(30)34(45)24-42-22-27-8-3-4-9-29(27)40-42)50-31-12-10-26(20-32(31)48-2)11-13-33(44)38-16-7-18-41/h3-4,8-10,12,14,19-20,22,28,30H,5-7,11,13,15-18,21,23-24H2,1-2H3,(H,38,44)(H,39,46)/t28-,30-/m0/s1 |
| InChIKey | QQEICEQIUPWPNI-JDXGNMNLSA-N |
| XLogP | 3.49 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |