C17H25NO3S — CID 135114822
(1R,3R,4S)-4-hydroxy-3-methoxy-N-[(5-methylthiophen-2-yl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide (PubChem CID 135114822) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (1R,3R,4S)-4-hydroxy-3-methoxy-N-[(5-methylthiophen-2-yl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide.
| Compound Name | (1R,3R,4S)-4-hydroxy-3-methoxy-N-[(5-methylthiophen-2-yl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 135114822 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (1R,3R,4S)-4-hydroxy-3-methoxy-N-[(5-methylthiophen-2-yl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide |
| SMILES | C=CCN(Cc1ccc(C)s1)C(=O)[C@@H]1CC[C@H](O)[C@H](OC)C1 |
| InChI | InChI=1S/C17H25NO3S/c1-4-9-18(11-14-7-5-12(2)22-14)17(20)13-6-8-15(19)16(10-13)21-3/h4-5,7,13,15-16,19H,1,6,8-11H2,2-3H3/t13-,15+,16-/m1/s1 |
| InChIKey | QMRMBDUEVCGZNH-VNQPRFMTSA-N |
| XLogP | 2.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|