C16H24N2O — CID 135115273
(3aR,4R,7aS)-4-ethyl-2-(5-methyl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 135115273) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-ethyl-2-(5-methyl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aR,4R,7aS)-4-ethyl-2-(5-methyl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 135115273 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (3aR,4R,7aS)-4-ethyl-2-(5-methyl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(c3ccc(C)cn3)C[C@@H]21 |
| InChI | InChI=1S/C16H24N2O/c1-3-16(19)8-4-5-13-10-18(11-14(13)16)15-7-6-12(2)9-17-15/h6-7,9,13-14,19H,3-5,8,10-11H2,1-2H3/t13-,14+,16-/m1/s1 |
| InChIKey | PHLSKVOILLGSAJ-IJEWVQPXSA-N |
| XLogP | 2.77 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |