C21H31N3 — CID 135116045
(3aR,6aS)-2-N,2-N,5-N-trimethyl-5-N-[(1-methylindol-4-yl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine (PubChem CID 135116045) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is (3aR,6aS)-2-N,2-N,5-N-trimethyl-5-N-[(1-methylindol-4-yl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine.
| Compound Name | (3aR,6aS)-2-N,2-N,5-N-trimethyl-5-N-[(1-methylindol-4-yl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine |
|---|---|
| PubChem CID | 135116045 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | (3aR,6aS)-2-N,2-N,5-N-trimethyl-5-N-[(1-methylindol-4-yl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)Cc3cccc4c3ccn4C)C[C@@H]2C1 |
| InChI | InChI=1S/C21H31N3/c1-22(2)18-10-16-12-19(13-17(16)11-18)24(4)14-15-6-5-7-21-20(15)8-9-23(21)3/h5-9,16-19H,10-14H2,1-4H3/t16-,17+,18?,19? |
| InChIKey | PADAFMBCWXSWHF-LPOKXYRGSA-N |
| XLogP | 3.73 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |