C18H22N4O2S — CID 135117245
(3-piperidin-1-ylazetidin-1-yl)-[5-(pyrimidin-2-ylsulfanylmethyl)furan-2-yl]methanone (PubChem CID 135117245) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is (3-piperidin-1-ylazetidin-1-yl)-[5-(pyrimidin-2-ylsulfanylmethyl)furan-2-yl]methanone.
| Compound Name | (3-piperidin-1-ylazetidin-1-yl)-[5-(pyrimidin-2-ylsulfanylmethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 135117245 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (3-piperidin-1-ylazetidin-1-yl)-[5-(pyrimidin-2-ylsulfanylmethyl)furan-2-yl]methanone |
| SMILES | O=C(c1ccc(CSc2ncccn2)o1)N1CC(N2CCCCC2)C1 |
| InChI | InChI=1S/C18H22N4O2S/c23-17(22-11-14(12-22)21-9-2-1-3-10-21)16-6-5-15(24-16)13-25-18-19-7-4-8-20-18/h4-8,14H,1-3,9-13H2 |
| InChIKey | QKWVQFOMVFKZIT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |